C24H21BrClN3O3 — CID 126269494
4-bromo-N-[(E)-[5-chloro-2-[2-(2,3-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (PubChem CID 126269494) has the molecular formula C24H21BrClN3O3 and a molecular weight of 514.81 g/mol. Its IUPAC name is 4-bromo-N-[(E)-[5-chloro-2-[2-(2,3-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-bromo-N-[(E)-[5-chloro-2-[2-(2,3-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126269494 |
| Molecular Formula | C24H21BrClN3O3 |
| Molecular Weight | 514.81 g/mol |
| Exact Mass | 513.05 |
| IUPAC Name | 4-bromo-N-[(E)-[5-chloro-2-[2-(2,3-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| SMILES | Cc1cccc(NC(=O)COc2ccc(Cl)cc2/C=N/NC(=O)c2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C24H21BrClN3O3/c1-15-4-3-5-21(16(15)2)28-23(30)14-32-22-11-10-20(26)12-18(22)13-27-29-24(31)17-6-8-19(25)9-7-17/h3-13H,14H2,1-2H3,(H,28,30)(H,29,31)/b27-13+ |
| InChIKey | MBZWWCCKQWTBST-UVHMKAGCSA-N |
| XLogP | 5.50 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.81 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|