C26H24ClFN4O5 — CID 126270578
N'-[(Z)-[4-[2-(3-chloro-4-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-[(4-methylphenyl)methyl]oxamide (PubChem CID 126270578) has the molecular formula C26H24ClFN4O5 and a molecular weight of 526.95 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(3-chloro-4-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-[(4-methylphenyl)methyl]oxamide.
| Compound Name | N'-[(Z)-[4-[2-(3-chloro-4-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-[(4-methylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 126270578 |
| Molecular Formula | C26H24ClFN4O5 |
| Molecular Weight | 526.95 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | N'-[(Z)-[4-[2-(3-chloro-4-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-[(4-methylphenyl)methyl]oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)NCc2ccc(C)cc2)ccc1OCC(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C26H24ClFN4O5/c1-16-3-5-17(6-4-16)13-29-25(34)26(35)32-30-14-18-7-10-22(23(11-18)36-2)37-15-24(33)31-19-8-9-21(28)20(27)12-19/h3-12,14H,13,15H2,1-2H3,(H,29,34)(H,31,33)(H,32,35)/b30-14- |
| InChIKey | KBAXPYUTWYDFLB-CPDSRJINSA-N |
| XLogP | 3.58 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.95 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|