About 2-(4-methylphenyl)-1,4,6-triphenylpyridin-1-ium perchlorate
2-(4-methylphenyl)-1,4,6-triphenylpyridin-1-ium perchlorate (PubChem CID 12627144) has the molecular formula C30H24ClNO4
and a molecular weight of 497.98 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1,4,6-triphenylpyridin-1-ium perchlorate.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)-1,4,6-triphenylpyridin-1-ium perchlorate |
| PubChem CID | 12627144 |
| Molecular Formula | C30H24ClNO4 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | 2-(4-methylphenyl)-1,4,6-triphenylpyridin-1-ium perchlorate |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)cc(-c3ccccc3)[n+]2-c2ccccc2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C30H24N.ClHO4/c1-23-17-19-26(20-18-23)30-22-27(24-11-5-2-6-12-24)21-29(25-13-7-3-8-14-25)31(30)28-15-9-4-10-16-28;2-1(3,4)5/h2-22H,1H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | QYZYUHRIJCKHDN-UHFFFAOYSA-M |
| XLogP | 2.52 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylphenyl)-1,4,6-triphenylpyridin-1-ium perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)-1,4,6-triphenylpyridin-1-ium perchlorate?
The IUPAC name of 2-(4-methylphenyl)-1,4,6-triphenylpyridin-1-ium perchlorate (CID 12627144) is 2-(4-methylphenyl)-1,4,6-triphenylpyridin-1-ium perchlorate.
What is the SMILES notation for 2-(4-methylphenyl)-1,4,6-triphenylpyridin-1-ium perchlorate?
The canonical SMILES for 2-(4-methylphenyl)-1,4,6-triphenylpyridin-1-ium perchlorate is Cc1ccc(-c2cc(-c3ccccc3)cc(-c3ccccc3)[n+]2-c2ccccc2)cc1.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of 2-(4-methylphenyl)-1,4,6-triphenylpyridin-1-ium perchlorate?
The InChIKey is QYZYUHRIJCKHDN-UHFFFAOYSA-M. The full InChI is InChI=1S/C30H24N.ClHO4/c1-23-17-19-26(20-18-23)30-22-27(24-11-5-2-6-12-24)21-29(25-13-7-3-8-14-25)31(30)28-15-9-4-10-16-28;2-1(3,4)5/h2-22H,1H3;(H,2,3,4,5)/q+1;/p-1.
What are the key properties of 2-(4-methylphenyl)-1,4,6-triphenylpyridin-1-ium perchlorate?
2-(4-methylphenyl)-1,4,6-triphenylpyridin-1-ium perchlorate has a molecular weight of 497.98 g/mol, XLogP of 2.52, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)-1,4,6-triphenylpyridin-1-ium perchlorate is sourced from PubChem (CID 12627144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).