C25H25ClN2O5S2 — CID 126271904
N-(3-chloro-4-methylphenyl)-2-[2-methoxy-4-[(Z)-[4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126271904) has the molecular formula C25H25ClN2O5S2 and a molecular weight of 533.07 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[2-methoxy-4-[(Z)-[4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[2-methoxy-4-[(Z)-[4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126271904 |
| Molecular Formula | C25H25ClN2O5S2 |
| Molecular Weight | 533.07 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[2-methoxy-4-[(Z)-[4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | COc1cc(/C=C2\SC(=S)N(C[C@H]3CCCO3)C2=O)ccc1OCC(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C25H25ClN2O5S2/c1-15-5-7-17(12-19(15)26)27-23(29)14-33-20-8-6-16(10-21(20)31-2)11-22-24(30)28(25(34)35-22)13-18-4-3-9-32-18/h5-8,10-12,18H,3-4,9,13-14H2,1-2H3,(H,27,29)/b22-11-/t18-/m1/s1 |
| InChIKey | OHEWFCGLRGDFJD-DSDJNCIMSA-N |
| XLogP | 5.05 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.07 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|