C26H25ClF3N3O4S — CID 126273038
2-[[2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]acetyl]amino]-N-butylbenzamide (PubChem CID 126273038) has the molecular formula C26H25ClF3N3O4S and a molecular weight of 568.02 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]acetyl]amino]-N-butylbenzamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]acetyl]amino]-N-butylbenzamide |
|---|---|
| PubChem CID | 126273038 |
| Molecular Formula | C26H25ClF3N3O4S |
| Molecular Weight | 568.02 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]acetyl]amino]-N-butylbenzamide |
| SMILES | CCCCNC(=O)c1ccccc1NC(=O)CN(c1ccc(Cl)c(C(F)(F)F)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H25ClF3N3O4S/c1-2-3-15-31-25(35)20-11-7-8-12-23(20)32-24(34)17-33(38(36,37)19-9-5-4-6-10-19)18-13-14-22(27)21(16-18)26(28,29)30/h4-14,16H,2-3,15,17H2,1H3,(H,31,35)(H,32,34) |
| InChIKey | RWHBFIAXXMJBEB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.02 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|