C14H17ClN2OS2 — CID 126273536
N-[(Z)-1-(4-chlorophenyl)ethylideneamino]-2-(2-methyl-1,3-dithiolan-2-yl)acetamide (PubChem CID 126273536) has the molecular formula C14H17ClN2OS2 and a molecular weight of 328.89 g/mol. Its IUPAC name is N-[(Z)-1-(4-chlorophenyl)ethylideneamino]-2-(2-methyl-1,3-dithiolan-2-yl)acetamide.
| Compound Name | N-[(Z)-1-(4-chlorophenyl)ethylideneamino]-2-(2-methyl-1,3-dithiolan-2-yl)acetamide |
|---|---|
| PubChem CID | 126273536 |
| Molecular Formula | C14H17ClN2OS2 |
| Molecular Weight | 328.89 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | N-[(Z)-1-(4-chlorophenyl)ethylideneamino]-2-(2-methyl-1,3-dithiolan-2-yl)acetamide |
| SMILES | C/C(=N/NC(=O)CC1(C)SCCS1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H17ClN2OS2/c1-10(11-3-5-12(15)6-4-11)16-17-13(18)9-14(2)19-7-8-20-14/h3-6H,7-9H2,1-2H3,(H,17,18)/b16-10- |
| InChIKey | VFCDNKGUMBBTGF-YBEGLDIGSA-N |
| XLogP | 3.77 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.89 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|