About 7-(trifluoromethyl)-2,1-benzothiazol-3-amine
7-(trifluoromethyl)-2,1-benzothiazol-3-amine (PubChem CID 12627364) has the molecular formula C8H5F3N2S
and a molecular weight of 218.20 g/mol. Its IUPAC name is 7-(trifluoromethyl)-2,1-benzothiazol-3-amine.
Molecular Properties
| Compound Name | 7-(trifluoromethyl)-2,1-benzothiazol-3-amine |
| PubChem CID | 12627364 |
| Molecular Formula | C8H5F3N2S |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | 7-(trifluoromethyl)-2,1-benzothiazol-3-amine |
| SMILES | Nc1snc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C8H5F3N2S/c9-8(10,11)5-3-1-2-4-6(5)13-14-7(4)12/h1-3H,12H2 |
| InChIKey | YBCLBTOSLBIRTM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(trifluoromethyl)-2,1-benzothiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(trifluoromethyl)-2,1-benzothiazol-3-amine?
The IUPAC name of 7-(trifluoromethyl)-2,1-benzothiazol-3-amine (CID 12627364) is 7-(trifluoromethyl)-2,1-benzothiazol-3-amine.
What is the SMILES notation for 7-(trifluoromethyl)-2,1-benzothiazol-3-amine?
The canonical SMILES for 7-(trifluoromethyl)-2,1-benzothiazol-3-amine is Nc1snc2c(C(F)(F)F)cccc12.
What is the InChIKey of 7-(trifluoromethyl)-2,1-benzothiazol-3-amine?
The InChIKey is YBCLBTOSLBIRTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F3N2S/c9-8(10,11)5-3-1-2-4-6(5)13-14-7(4)12/h1-3H,12H2.
What are the key properties of 7-(trifluoromethyl)-2,1-benzothiazol-3-amine?
7-(trifluoromethyl)-2,1-benzothiazol-3-amine has a molecular weight of 218.20 g/mol, XLogP of 2.90, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(trifluoromethyl)-2,1-benzothiazol-3-amine is sourced from PubChem (CID 12627364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).