C12H23NO — CID 12627395
4-ethenyl-1,2,2,6,6-pentamethylpiperidin-4-ol (PubChem CID 12627395) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 4-ethenyl-1,2,2,6,6-pentamethylpiperidin-4-ol.
| Compound Name | 4-ethenyl-1,2,2,6,6-pentamethylpiperidin-4-ol |
|---|---|
| PubChem CID | 12627395 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 4-ethenyl-1,2,2,6,6-pentamethylpiperidin-4-ol |
| SMILES | C=CC1(O)CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C12H23NO/c1-7-12(14)8-10(2,3)13(6)11(4,5)9-12/h7,14H,1,8-9H2,2-6H3 |
| InChIKey | HQJAXPYALOWYBZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|