C28H30N4O5 — CID 126274175
N'-[(Z)-[4-[2-(2,5-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-(2-ethylphenyl)oxamide (PubChem CID 126274175) has the molecular formula C28H30N4O5 and a molecular weight of 502.57 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(2,5-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-(2-ethylphenyl)oxamide.
| Compound Name | N'-[(Z)-[4-[2-(2,5-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-(2-ethylphenyl)oxamide |
|---|---|
| PubChem CID | 126274175 |
| Molecular Formula | C28H30N4O5 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | N'-[(Z)-[4-[2-(2,5-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-(2-ethylphenyl)oxamide |
| SMILES | CCc1ccccc1NC(=O)C(=O)N/N=C\c1ccc(OCC(=O)Nc2cc(C)ccc2C)c(OC)c1 |
| InChI | InChI=1S/C28H30N4O5/c1-5-21-8-6-7-9-22(21)31-27(34)28(35)32-29-16-20-12-13-24(25(15-20)36-4)37-17-26(33)30-23-14-18(2)10-11-19(23)3/h6-16H,5,17H2,1-4H3,(H,30,33)(H,31,34)(H,32,35)/b29-16- |
| InChIKey | YPYNJCKLMWEWCG-MWLSYYOVSA-N |
| XLogP | 3.98 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|