C22H19IN2O5S — CID 126274709
2-[N-(benzenesulfonyl)-4-iodoanilino]-N-(1,3-benzodioxol-5-ylmethyl)acetamide (PubChem CID 126274709) has the molecular formula C22H19IN2O5S and a molecular weight of 550.37 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-(1,3-benzodioxol-5-ylmethyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-(1,3-benzodioxol-5-ylmethyl)acetamide |
|---|---|
| PubChem CID | 126274709 |
| Molecular Formula | C22H19IN2O5S |
| Molecular Weight | 550.37 g/mol |
| Exact Mass | 550.01 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-(1,3-benzodioxol-5-ylmethyl)acetamide |
| SMILES | O=C(CN(c1ccc(I)cc1)S(=O)(=O)c1ccccc1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H19IN2O5S/c23-17-7-9-18(10-8-17)25(31(27,28)19-4-2-1-3-5-19)14-22(26)24-13-16-6-11-20-21(12-16)30-15-29-20/h1-12H,13-15H2,(H,24,26) |
| InChIKey | VLGMNXNTSUDWKN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|