C14H8N2O3 — CID 12627733
2-nitro-6-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),8,10,12-hexaen-7-one (PubChem CID 12627733) has the molecular formula C14H8N2O3 and a molecular weight of 252.23 g/mol. Its IUPAC name is 2-nitro-6-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),8,10,12-hexaen-7-one.
| Compound Name | 2-nitro-6-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),8,10,12-hexaen-7-one |
|---|---|
| PubChem CID | 12627733 |
| Molecular Formula | C14H8N2O3 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 2-nitro-6-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),8,10,12-hexaen-7-one |
| SMILES | O=c1[nH]c2ccc([N+](=O)[O-])c3c2c2c(cccc12)C3 |
| InChI | InChI=1S/C14H8N2O3/c17-14-8-3-1-2-7-6-9-11(16(18)19)5-4-10(15-14)13(9)12(7)8/h1-5H,6H2,(H,15,17) |
| InChIKey | FNBZRTNGUDSTTB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|