About N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 1262825) has the molecular formula C20H23N5O4S
and a molecular weight of 429.50 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide.
Molecular Properties
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide |
| PubChem CID | 1262825 |
| Molecular Formula | C20H23N5O4S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | COc1ccc(CCNC(=O)CSc2nnnn2-c2ccccc2OC)cc1OC |
| InChI | InChI=1S/C20H23N5O4S/c1-27-16-7-5-4-6-15(16)25-20(22-23-24-25)30-13-19(26)21-11-10-14-8-9-17(28-2)18(12-14)29-3/h4-9,12H,10-11,13H2,1-3H3,(H,21,26) |
| InChIKey | CFARPYFSDUROHL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide?
The IUPAC name of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide (CID 1262825) is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide.
What is the SMILES notation for N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide?
The canonical SMILES for N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide is COc1ccc(CCNC(=O)CSc2nnnn2-c2ccccc2OC)cc1OC.
What is the InChIKey of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide?
The InChIKey is CFARPYFSDUROHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N5O4S/c1-27-16-7-5-4-6-15(16)25-20(22-23-24-25)30-13-19(26)21-11-10-14-8-9-17(28-2)18(12-14)29-3/h4-9,12H,10-11,13H2,1-3H3,(H,21,26).
What are the key properties of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide?
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide has a molecular weight of 429.50 g/mol, XLogP of 2.14, 10 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide is sourced from PubChem (CID 1262825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).