About (2E,4E)-N,N-dimethylhexa-2,4-dien-1-amine
(2E,4E)-N,N-dimethylhexa-2,4-dien-1-amine (PubChem CID 12628261) has the molecular formula C8H15N
and a molecular weight of 125.21 g/mol. Its IUPAC name is (2E,4E)-N,N-dimethylhexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | (2E,4E)-N,N-dimethylhexa-2,4-dien-1-amine |
| PubChem CID | 12628261 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | (2E,4E)-N,N-dimethylhexa-2,4-dien-1-amine |
| SMILES | C/C=C/C=C/CN(C)C |
| InChI | InChI=1S/C8H15N/c1-4-5-6-7-8-9(2)3/h4-7H,8H2,1-3H3/b5-4+,7-6+ |
| InChIKey | OQNQVZSWWQGUQG-YTXTXJHMSA-N |
| XLogP | 1.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-N,N-dimethylhexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-N,N-dimethylhexa-2,4-dien-1-amine?
The IUPAC name of (2E,4E)-N,N-dimethylhexa-2,4-dien-1-amine (CID 12628261) is (2E,4E)-N,N-dimethylhexa-2,4-dien-1-amine.
What is the SMILES notation for (2E,4E)-N,N-dimethylhexa-2,4-dien-1-amine?
The canonical SMILES for (2E,4E)-N,N-dimethylhexa-2,4-dien-1-amine is C/C=C/C=C/CN(C)C.
What is the InChIKey of (2E,4E)-N,N-dimethylhexa-2,4-dien-1-amine?
The InChIKey is OQNQVZSWWQGUQG-YTXTXJHMSA-N. The full InChI is InChI=1S/C8H15N/c1-4-5-6-7-8-9(2)3/h4-7H,8H2,1-3H3/b5-4+,7-6+.
What are the key properties of (2E,4E)-N,N-dimethylhexa-2,4-dien-1-amine?
(2E,4E)-N,N-dimethylhexa-2,4-dien-1-amine has a molecular weight of 125.21 g/mol, XLogP of 1.68, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-N,N-dimethylhexa-2,4-dien-1-amine is sourced from PubChem (CID 12628261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).