C19H18N2O7 — CID 126283455
[[(3aR,4S,7R,7aS)-1,3-dioxo-2-(pyridin-2-ylmethyl)-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]-acetyloxymethyl] acetate (PubChem CID 126283455) has the molecular formula C19H18N2O7 and a molecular weight of 386.36 g/mol. Its IUPAC name is [[(3aR,4S,7R,7aS)-1,3-dioxo-2-(pyridin-2-ylmethyl)-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]-acetyloxymethyl] acetate.
| Compound Name | [[(3aR,4S,7R,7aS)-1,3-dioxo-2-(pyridin-2-ylmethyl)-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]-acetyloxymethyl] acetate |
|---|---|
| PubChem CID | 126283455 |
| Molecular Formula | C19H18N2O7 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | [[(3aR,4S,7R,7aS)-1,3-dioxo-2-(pyridin-2-ylmethyl)-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]-acetyloxymethyl] acetate |
| SMILES | CC(=O)OC(OC(C)=O)[C@@]12C=C[C@@H](O1)[C@H]1C(=O)N(Cc3ccccn3)C(=O)[C@H]12 |
| InChI | InChI=1S/C19H18N2O7/c1-10(22)26-18(27-11(2)23)19-7-6-13(28-19)14-15(19)17(25)21(16(14)24)9-12-5-3-4-8-20-12/h3-8,13-15,18H,9H2,1-2H3/t13-,14-,15+,19+/m1/s1 |
| InChIKey | AOYCYMOMLKBUFN-CUYVQJCZSA-N |
| XLogP | 0.34 |
| TPSA | 112.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|