About 5,8-dimethyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid
5,8-dimethyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid (PubChem CID 12628431) has the molecular formula C14H11NO4
and a molecular weight of 257.25 g/mol. Its IUPAC name is 5,8-dimethyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 5,8-dimethyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid |
| PubChem CID | 12628431 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 5,8-dimethyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid |
| SMILES | Cc1ccc2c(c1)c1oc(C(=O)O)cc(=O)c1n2C |
| InChI | InChI=1S/C14H11NO4/c1-7-3-4-9-8(5-7)13-12(15(9)2)10(16)6-11(19-13)14(17)18/h3-6H,1-2H3,(H,17,18) |
| InChIKey | PSVKWPLBQFFGNI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,8-dimethyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-dimethyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid?
The IUPAC name of 5,8-dimethyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid (CID 12628431) is 5,8-dimethyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid.
What is the SMILES notation for 5,8-dimethyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid?
The canonical SMILES for 5,8-dimethyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid is Cc1ccc2c(c1)c1oc(C(=O)O)cc(=O)c1n2C.
What is the InChIKey of 5,8-dimethyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid?
The InChIKey is PSVKWPLBQFFGNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO4/c1-7-3-4-9-8(5-7)13-12(15(9)2)10(16)6-11(19-13)14(17)18/h3-6H,1-2H3,(H,17,18).
What are the key properties of 5,8-dimethyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid?
5,8-dimethyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid has a molecular weight of 257.25 g/mol, XLogP of 2.29, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dimethyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid is sourced from PubChem (CID 12628431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).