C26H17Cl2N3O5 — CID 126284924
methyl 2-[4-chloro-2-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetate (PubChem CID 126284924) has the molecular formula C26H17Cl2N3O5 and a molecular weight of 522.34 g/mol. Its IUPAC name is methyl 2-[4-chloro-2-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-chloro-2-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126284924 |
| Molecular Formula | C26H17Cl2N3O5 |
| Molecular Weight | 522.34 g/mol |
| Exact Mass | 521.05 |
| IUPAC Name | methyl 2-[4-chloro-2-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(Cl)cc1C=Nn1c(-c2cc3cc(Cl)ccc3o2)nc2ccccc2c1=O |
| InChI | InChI=1S/C26H17Cl2N3O5/c1-34-24(32)14-35-21-8-6-18(28)11-16(21)13-29-31-25(30-20-5-3-2-4-19(20)26(31)33)23-12-15-10-17(27)7-9-22(15)36-23/h2-13H,14H2,1H3 |
| InChIKey | FCONZLXBQDLDIB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 95.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.34 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|