C25H16Br3N3O4 — CID 126285374
2-(5-bromo-1-benzofuran-2-yl)-3-[(2,3-dibromo-4,5-dimethoxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126285374) has the molecular formula C25H16Br3N3O4 and a molecular weight of 662.13 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-2-yl)-3-[(2,3-dibromo-4,5-dimethoxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[(2,3-dibromo-4,5-dimethoxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126285374 |
| Molecular Formula | C25H16Br3N3O4 |
| Molecular Weight | 662.13 g/mol |
| Exact Mass | 658.87 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[(2,3-dibromo-4,5-dimethoxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(-c3cc4cc(Br)ccc4o3)nc3ccccc3c2=O)c(Br)c(Br)c1OC |
| InChI | InChI=1S/C25H16Br3N3O4/c1-33-19-11-14(21(27)22(28)23(19)34-2)12-29-31-24(30-17-6-4-3-5-16(17)25(31)32)20-10-13-9-15(26)7-8-18(13)35-20/h3-12H,1-2H3 |
| InChIKey | GFSDQXDHHHSLGZ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 78.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.13 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|