C26H20Br2Cl2N4O4 — CID 126291736
6-bromo-3-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-tert-butylquinazolin-4-one (PubChem CID 126291736) has the molecular formula C26H20Br2Cl2N4O4 and a molecular weight of 683.18 g/mol. Its IUPAC name is 6-bromo-3-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-tert-butylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-tert-butylquinazolin-4-one |
|---|---|
| PubChem CID | 126291736 |
| Molecular Formula | C26H20Br2Cl2N4O4 |
| Molecular Weight | 683.18 g/mol |
| Exact Mass | 679.92 |
| IUPAC Name | 6-bromo-3-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-tert-butylquinazolin-4-one |
| SMILES | CC(C)(C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Br)cc([N+](=O)[O-])c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H20Br2Cl2N4O4/c1-26(2,3)25-32-21-7-5-16(27)10-18(21)24(35)33(25)31-12-15-9-17(28)11-22(34(36)37)23(15)38-13-14-4-6-19(29)20(30)8-14/h4-12H,13H2,1-3H3 |
| InChIKey | XCGHFIRGKVMPMC-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.18 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|