About 5-benzyl-2,3-dihydro-1,5-benzothiazepin-4-one
5-benzyl-2,3-dihydro-1,5-benzothiazepin-4-one (PubChem CID 12629212) has the molecular formula C16H15NOS
and a molecular weight of 269.37 g/mol. Its IUPAC name is 5-benzyl-2,3-dihydro-1,5-benzothiazepin-4-one.
Molecular Properties
| Compound Name | 5-benzyl-2,3-dihydro-1,5-benzothiazepin-4-one |
| PubChem CID | 12629212 |
| Molecular Formula | C16H15NOS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 5-benzyl-2,3-dihydro-1,5-benzothiazepin-4-one |
| SMILES | O=C1CCSc2ccccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C16H15NOS/c18-16-10-11-19-15-9-5-4-8-14(15)17(16)12-13-6-2-1-3-7-13/h1-9H,10-12H2 |
| InChIKey | SZCPFKAKAAZJDH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-benzyl-2,3-dihydro-1,5-benzothiazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-2,3-dihydro-1,5-benzothiazepin-4-one?
The IUPAC name of 5-benzyl-2,3-dihydro-1,5-benzothiazepin-4-one (CID 12629212) is 5-benzyl-2,3-dihydro-1,5-benzothiazepin-4-one.
What is the SMILES notation for 5-benzyl-2,3-dihydro-1,5-benzothiazepin-4-one?
The canonical SMILES for 5-benzyl-2,3-dihydro-1,5-benzothiazepin-4-one is O=C1CCSc2ccccc2N1Cc1ccccc1.
What is the InChIKey of 5-benzyl-2,3-dihydro-1,5-benzothiazepin-4-one?
The InChIKey is SZCPFKAKAAZJDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NOS/c18-16-10-11-19-15-9-5-4-8-14(15)17(16)12-13-6-2-1-3-7-13/h1-9H,10-12H2.
What are the key properties of 5-benzyl-2,3-dihydro-1,5-benzothiazepin-4-one?
5-benzyl-2,3-dihydro-1,5-benzothiazepin-4-one has a molecular weight of 269.37 g/mol, XLogP of 3.72, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-2,3-dihydro-1,5-benzothiazepin-4-one is sourced from PubChem (CID 12629212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).