C30H34F2N2O4 — CID 126292828
methyl (1R,3aR,6aR)-5-(4-tert-butylcyclohexyl)-3,3-bis(4-fluorophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate (PubChem CID 126292828) has the molecular formula C30H34F2N2O4 and a molecular weight of 524.61 g/mol. Its IUPAC name is methyl (1R,3aR,6aR)-5-(4-tert-butylcyclohexyl)-3,3-bis(4-fluorophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate.
| Compound Name | methyl (1R,3aR,6aR)-5-(4-tert-butylcyclohexyl)-3,3-bis(4-fluorophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 126292828 |
| Molecular Formula | C30H34F2N2O4 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | methyl (1R,3aR,6aR)-5-(4-tert-butylcyclohexyl)-3,3-bis(4-fluorophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate |
| SMILES | COC(=O)[C@@H]1NC(c2ccc(F)cc2)(c2ccc(F)cc2)[C@@H]2C(=O)N(C3CCC(C(C)(C)C)CC3)C(=O)[C@H]21 |
| InChI | InChI=1S/C30H34F2N2O4/c1-29(2,3)17-9-15-22(16-10-17)34-26(35)23-24(27(34)36)30(33-25(23)28(37)38-4,18-5-11-20(31)12-6-18)19-7-13-21(32)14-8-19/h5-8,11-14,17,22-25,33H,9-10,15-16H2,1-4H3/t17?,22?,23-,24+,25-/m1/s1 |
| InChIKey | ZGUBYCBZQQWVPF-AVFLBYNRSA-N |
| XLogP | 4.56 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|