C34H21BrClN3O3 — CID 126296135
2-(5-bromo-1-benzofuran-2-yl)-3-[[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]quinazolin-4-one (PubChem CID 126296135) has the molecular formula C34H21BrClN3O3 and a molecular weight of 634.92 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-2-yl)-3-[[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126296135 |
| Molecular Formula | C34H21BrClN3O3 |
| Molecular Weight | 634.92 g/mol |
| Exact Mass | 633.05 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cc3cc(Br)ccc3o2)n1N=Cc1c(OCc2ccccc2Cl)ccc2ccccc12 |
| InChI | InChI=1S/C34H21BrClN3O3/c35-24-14-16-30-23(17-24)18-32(42-30)33-38-29-12-6-4-10-26(29)34(40)39(33)37-19-27-25-9-3-1-7-21(25)13-15-31(27)41-20-22-8-2-5-11-28(22)36/h1-19H,20H2 |
| InChIKey | QARZZCWILYGZQT-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 69.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.92 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|