C28H27Br2N3O4 — CID 126297642
6-bromo-3-[[4-[(4-bromophenyl)methoxy]-3,5-dimethoxyphenyl]methylideneamino]-2-tert-butylquinazolin-4-one (PubChem CID 126297642) has the molecular formula C28H27Br2N3O4 and a molecular weight of 629.35 g/mol. Its IUPAC name is 6-bromo-3-[[4-[(4-bromophenyl)methoxy]-3,5-dimethoxyphenyl]methylideneamino]-2-tert-butylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[4-[(4-bromophenyl)methoxy]-3,5-dimethoxyphenyl]methylideneamino]-2-tert-butylquinazolin-4-one |
|---|---|
| PubChem CID | 126297642 |
| Molecular Formula | C28H27Br2N3O4 |
| Molecular Weight | 629.35 g/mol |
| Exact Mass | 627.04 |
| IUPAC Name | 6-bromo-3-[[4-[(4-bromophenyl)methoxy]-3,5-dimethoxyphenyl]methylideneamino]-2-tert-butylquinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(C(C)(C)C)nc3ccc(Br)cc3c2=O)cc(OC)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C28H27Br2N3O4/c1-28(2,3)27-32-22-11-10-20(30)14-21(22)26(34)33(27)31-15-18-12-23(35-4)25(24(13-18)36-5)37-16-17-6-8-19(29)9-7-17/h6-15H,16H2,1-5H3 |
| InChIKey | PYRCRTSXEKULJS-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.35 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|