C35H33N3O5 — CID 126297671
4-[[3-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid (PubChem CID 126297671) has the molecular formula C35H33N3O5 and a molecular weight of 575.67 g/mol. Its IUPAC name is 4-[[3-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[3-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126297671 |
| Molecular Formula | C35H33N3O5 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | 4-[[3-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cccc(OCc3ccc(C(=O)O)cc3)c2)cc1C(C)C |
| InChI | InChI=1S/C35H33N3O5/c1-5-42-32-17-23(4)30(19-29(32)22(2)3)33-37-31-12-7-6-11-28(31)34(39)38(33)36-20-25-9-8-10-27(18-25)43-21-24-13-15-26(16-14-24)35(40)41/h6-20,22H,5,21H2,1-4H3,(H,40,41) |
| InChIKey | QAIKUZYGLXNVAL-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|