About 1-methylpiperidin-3-one;hydrochloride
1-methylpiperidin-3-one;hydrochloride (PubChem CID 12629791) has the molecular formula C6H12ClNO
and a molecular weight of 149.62 g/mol. Its IUPAC name is 1-methylpiperidin-3-one;hydrochloride.
Molecular Properties
| Compound Name | 1-methylpiperidin-3-one;hydrochloride |
| PubChem CID | 12629791 |
| Molecular Formula | C6H12ClNO |
| Molecular Weight | 149.62 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 1-methylpiperidin-3-one;hydrochloride |
| SMILES | CN1CCCC(=O)C1.Cl |
| InChI | InChI=1S/C6H11NO.ClH/c1-7-4-2-3-6(8)5-7;/h2-5H2,1H3;1H |
| InChIKey | BLRLPMIRFPMIFG-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.62 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylpiperidin-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperidin-3-one;hydrochloride?
The IUPAC name of 1-methylpiperidin-3-one;hydrochloride (CID 12629791) is 1-methylpiperidin-3-one;hydrochloride.
What is the SMILES notation for 1-methylpiperidin-3-one;hydrochloride?
The canonical SMILES for 1-methylpiperidin-3-one;hydrochloride is CN1CCCC(=O)C1.Cl.
What is the InChIKey of 1-methylpiperidin-3-one;hydrochloride?
The InChIKey is BLRLPMIRFPMIFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.ClH/c1-7-4-2-3-6(8)5-7;/h2-5H2,1H3;1H.
What are the key properties of 1-methylpiperidin-3-one;hydrochloride?
1-methylpiperidin-3-one;hydrochloride has a molecular weight of 149.62 g/mol, XLogP of 0.70, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperidin-3-one;hydrochloride is sourced from PubChem (CID 12629791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).