C16H19NO4 — CID 12629855
methyl 1-[(2R,3S)-2-methyl-3-phenyloxirane-2-carbonyl]pyrrolidine-2-carboxylate (PubChem CID 12629855) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is methyl 1-[(2R,3S)-2-methyl-3-phenyloxirane-2-carbonyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[(2R,3S)-2-methyl-3-phenyloxirane-2-carbonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 12629855 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | methyl 1-[(2R,3S)-2-methyl-3-phenyloxirane-2-carbonyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1C(=O)[C@]1(C)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H19NO4/c1-16(13(21-16)11-7-4-3-5-8-11)15(19)17-10-6-9-12(17)14(18)20-2/h3-5,7-8,12-13H,6,9-10H2,1-2H3/t12?,13-,16+/m0/s1 |
| InChIKey | XBNKDBGIHWHWGV-XBUJOUKBSA-N |
| XLogP | 1.68 |
| TPSA | 59.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|