About methyl 1-[(2R,3S)-3-hexyl-2-methyloxirane-2-carbonyl]pyrrolidine-2-carboxylate
methyl 1-[(2R,3S)-3-hexyl-2-methyloxirane-2-carbonyl]pyrrolidine-2-carboxylate (PubChem CID 12629863) has the molecular formula C16H27NO4
and a molecular weight of 297.39 g/mol. Its IUPAC name is methyl 1-[(2R,3S)-3-hexyl-2-methyloxirane-2-carbonyl]pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[(2R,3S)-3-hexyl-2-methyloxirane-2-carbonyl]pyrrolidine-2-carboxylate |
| PubChem CID | 12629863 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | methyl 1-[(2R,3S)-3-hexyl-2-methyloxirane-2-carbonyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCCC[C@@H]1O[C@@]1(C)C(=O)N1CCCC1C(=O)OC |
| InChI | InChI=1S/C16H27NO4/c1-4-5-6-7-10-13-16(2,21-13)15(19)17-11-8-9-12(17)14(18)20-3/h12-13H,4-11H2,1-3H3/t12?,13-,16+/m0/s1 |
| InChIKey | ZCENJVCYBVUJAC-XBUJOUKBSA-N |
| XLogP | 2.28 |
| TPSA | 59.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[(2R,3S)-3-hexyl-2-methyloxirane-2-carbonyl]pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[(2R,3S)-3-hexyl-2-methyloxirane-2-carbonyl]pyrrolidine-2-carboxylate?
The IUPAC name of methyl 1-[(2R,3S)-3-hexyl-2-methyloxirane-2-carbonyl]pyrrolidine-2-carboxylate (CID 12629863) is methyl 1-[(2R,3S)-3-hexyl-2-methyloxirane-2-carbonyl]pyrrolidine-2-carboxylate.
What is the SMILES notation for methyl 1-[(2R,3S)-3-hexyl-2-methyloxirane-2-carbonyl]pyrrolidine-2-carboxylate?
The canonical SMILES for methyl 1-[(2R,3S)-3-hexyl-2-methyloxirane-2-carbonyl]pyrrolidine-2-carboxylate is CCCCCC[C@@H]1O[C@@]1(C)C(=O)N1CCCC1C(=O)OC.
What is the InChIKey of methyl 1-[(2R,3S)-3-hexyl-2-methyloxirane-2-carbonyl]pyrrolidine-2-carboxylate?
The InChIKey is ZCENJVCYBVUJAC-XBUJOUKBSA-N. The full InChI is InChI=1S/C16H27NO4/c1-4-5-6-7-10-13-16(2,21-13)15(19)17-11-8-9-12(17)14(18)20-3/h12-13H,4-11H2,1-3H3/t12?,13-,16+/m0/s1.
What are the key properties of methyl 1-[(2R,3S)-3-hexyl-2-methyloxirane-2-carbonyl]pyrrolidine-2-carboxylate?
methyl 1-[(2R,3S)-3-hexyl-2-methyloxirane-2-carbonyl]pyrrolidine-2-carboxylate has a molecular weight of 297.39 g/mol, XLogP of 2.28, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(2R,3S)-3-hexyl-2-methyloxirane-2-carbonyl]pyrrolidine-2-carboxylate is sourced from PubChem (CID 12629863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).