C26H20ClN3O4 — CID 126300999
2-(1-benzofuran-2-yl)-3-[(5-chloro-2-ethoxy-3-methoxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126300999) has the molecular formula C26H20ClN3O4 and a molecular weight of 473.92 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[(5-chloro-2-ethoxy-3-methoxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[(5-chloro-2-ethoxy-3-methoxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126300999 |
| Molecular Formula | C26H20ClN3O4 |
| Molecular Weight | 473.92 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[(5-chloro-2-ethoxy-3-methoxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | CCOc1c(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)cc(Cl)cc1OC |
| InChI | InChI=1S/C26H20ClN3O4/c1-3-33-24-17(12-18(27)14-22(24)32-2)15-28-30-25(23-13-16-8-4-7-11-21(16)34-23)29-20-10-6-5-9-19(20)26(30)31/h4-15H,3H2,1-2H3 |
| InChIKey | NATCXHCKHJVEOG-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 78.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.92 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|