C31H20BrClN4O6 — CID 126301254
2-(5-bromo-1-benzofuran-2-yl)-3-[[5-chloro-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one (PubChem CID 126301254) has the molecular formula C31H20BrClN4O6 and a molecular weight of 659.88 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-2-yl)-3-[[5-chloro-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[5-chloro-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126301254 |
| Molecular Formula | C31H20BrClN4O6 |
| Molecular Weight | 659.88 g/mol |
| Exact Mass | 658.03 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[5-chloro-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one |
| SMILES | COc1cc(Cl)cc(C=Nn2c(-c3cc4cc(Br)ccc4o3)nc3ccccc3c2=O)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H20BrClN4O6/c1-41-27-15-22(33)13-20(29(27)42-17-18-6-9-23(10-7-18)37(39)40)16-34-36-30(35-25-5-3-2-4-24(25)31(36)38)28-14-19-12-21(32)8-11-26(19)43-28/h2-16H,17H2,1H3 |
| InChIKey | CKOWCIGECQZCTE-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 121.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.88 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|