About 6-oxaspiro[4.5]decane
6-oxaspiro[4.5]decane (PubChem CID 12630235) has the molecular formula C9H16O
and a molecular weight of 140.23 g/mol. Its IUPAC name is 6-oxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 6-oxaspiro[4.5]decane |
| PubChem CID | 12630235 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 6-oxaspiro[4.5]decane |
| SMILES | C1CCC2(CCCC2)OC1 |
| InChI | InChI=1S/C9H16O/c1-2-6-9(5-1)7-3-4-8-10-9/h1-8H2 |
| InChIKey | WFFUVYLIAPPPGM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-oxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxaspiro[4.5]decane?
The IUPAC name of 6-oxaspiro[4.5]decane (CID 12630235) is 6-oxaspiro[4.5]decane.
What is the SMILES notation for 6-oxaspiro[4.5]decane?
The canonical SMILES for 6-oxaspiro[4.5]decane is C1CCC2(CCCC2)OC1.
What is the InChIKey of 6-oxaspiro[4.5]decane?
The InChIKey is WFFUVYLIAPPPGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O/c1-2-6-9(5-1)7-3-4-8-10-9/h1-8H2.
What are the key properties of 6-oxaspiro[4.5]decane?
6-oxaspiro[4.5]decane has a molecular weight of 140.23 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxaspiro[4.5]decane is sourced from PubChem (CID 12630235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).