About 8-bromo-3-cyclohexyl-6,7-dimethoxy-1H-cinnolin-4-one
8-bromo-3-cyclohexyl-6,7-dimethoxy-1H-cinnolin-4-one (PubChem CID 12630331) has the molecular formula C16H19BrN2O3
and a molecular weight of 367.24 g/mol. Its IUPAC name is 8-bromo-3-cyclohexyl-6,7-dimethoxy-1H-cinnolin-4-one.
Molecular Properties
| Compound Name | 8-bromo-3-cyclohexyl-6,7-dimethoxy-1H-cinnolin-4-one |
| PubChem CID | 12630331 |
| Molecular Formula | C16H19BrN2O3 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 8-bromo-3-cyclohexyl-6,7-dimethoxy-1H-cinnolin-4-one |
| SMILES | COc1cc2c(=O)c(C3CCCCC3)n[nH]c2c(Br)c1OC |
| InChI | InChI=1S/C16H19BrN2O3/c1-21-11-8-10-14(12(17)16(11)22-2)19-18-13(15(10)20)9-6-4-3-5-7-9/h8-9H,3-7H2,1-2H3,(H,19,20) |
| InChIKey | BRUKQYLBOHBZGA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-bromo-3-cyclohexyl-6,7-dimethoxy-1H-cinnolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-3-cyclohexyl-6,7-dimethoxy-1H-cinnolin-4-one?
The IUPAC name of 8-bromo-3-cyclohexyl-6,7-dimethoxy-1H-cinnolin-4-one (CID 12630331) is 8-bromo-3-cyclohexyl-6,7-dimethoxy-1H-cinnolin-4-one.
What is the SMILES notation for 8-bromo-3-cyclohexyl-6,7-dimethoxy-1H-cinnolin-4-one?
The canonical SMILES for 8-bromo-3-cyclohexyl-6,7-dimethoxy-1H-cinnolin-4-one is COc1cc2c(=O)c(C3CCCCC3)n[nH]c2c(Br)c1OC.
What is the InChIKey of 8-bromo-3-cyclohexyl-6,7-dimethoxy-1H-cinnolin-4-one?
The InChIKey is BRUKQYLBOHBZGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19BrN2O3/c1-21-11-8-10-14(12(17)16(11)22-2)19-18-13(15(10)20)9-6-4-3-5-7-9/h8-9H,3-7H2,1-2H3,(H,19,20).
What are the key properties of 8-bromo-3-cyclohexyl-6,7-dimethoxy-1H-cinnolin-4-one?
8-bromo-3-cyclohexyl-6,7-dimethoxy-1H-cinnolin-4-one has a molecular weight of 367.24 g/mol, XLogP of 3.75, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-3-cyclohexyl-6,7-dimethoxy-1H-cinnolin-4-one is sourced from PubChem (CID 12630331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).