C8H4N4O2 — CID 12630334
1,4,7,10-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-2,8-dione (PubChem CID 12630334) has the molecular formula C8H4N4O2 and a molecular weight of 188.15 g/mol. Its IUPAC name is 1,4,7,10-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-2,8-dione.
| Compound Name | 1,4,7,10-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-2,8-dione |
|---|---|
| PubChem CID | 12630334 |
| Molecular Formula | C8H4N4O2 |
| Molecular Weight | 188.15 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 1,4,7,10-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-2,8-dione |
| SMILES | O=c1c2nccn2c(=O)c2nccn12 |
| InChI | InChI=1S/C8H4N4O2/c13-7-5-9-1-3-11(5)8(14)6-10-2-4-12(6)7/h1-4H |
| InChIKey | SCHCQSDINJJQCW-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 68.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.15 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |