C25H17BrClN3O4 — CID 126304666
3-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-(5-chloro-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126304666) has the molecular formula C25H17BrClN3O4 and a molecular weight of 538.79 g/mol. Its IUPAC name is 3-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-(5-chloro-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-(5-chloro-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126304666 |
| Molecular Formula | C25H17BrClN3O4 |
| Molecular Weight | 538.79 g/mol |
| Exact Mass | 537.01 |
| IUPAC Name | 3-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-(5-chloro-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | COc1cc(OC)c(C=Nn2c(-c3cc4cc(Cl)ccc4o3)nc3ccccc3c2=O)cc1Br |
| InChI | InChI=1S/C25H17BrClN3O4/c1-32-21-12-22(33-2)18(26)10-15(21)13-28-30-24(29-19-6-4-3-5-17(19)25(30)31)23-11-14-9-16(27)7-8-20(14)34-23/h3-13H,1-2H3 |
| InChIKey | ZMYHRDOTBZXSHJ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 78.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.79 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|