C7H10O — CID 12630477
3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan (PubChem CID 12630477) has the molecular formula C7H10O and a molecular weight of 110.16 g/mol. Its IUPAC name is 3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan.
| Compound Name | 3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan |
|---|---|
| PubChem CID | 12630477 |
| Molecular Formula | C7H10O |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.07 |
| IUPAC Name | 3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan |
| SMILES | C1=CC2OCCC2C1 |
| InChI | InChI=1S/C7H10O/c1-2-6-4-5-8-7(6)3-1/h1,3,6-7H,2,4-5H2 |
| InChIKey | JRJPFFSJNFSDTG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|