C24H25BrN4O7 — CID 126306499
methyl (2R)-2-[4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methoxy-6-nitrophenoxy]propanoate (PubChem CID 126306499) has the molecular formula C24H25BrN4O7 and a molecular weight of 561.39 g/mol. Its IUPAC name is methyl (2R)-2-[4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methoxy-6-nitrophenoxy]propanoate.
| Compound Name | methyl (2R)-2-[4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methoxy-6-nitrophenoxy]propanoate |
|---|---|
| PubChem CID | 126306499 |
| Molecular Formula | C24H25BrN4O7 |
| Molecular Weight | 561.39 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | methyl (2R)-2-[4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methoxy-6-nitrophenoxy]propanoate |
| SMILES | COC(=O)[C@@H](C)Oc1c(OC)cc(C=Nn2c(C(C)(C)C)nc3ccc(Br)cc3c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H25BrN4O7/c1-13(22(31)35-6)36-20-18(29(32)33)9-14(10-19(20)34-5)12-26-28-21(30)16-11-15(25)7-8-17(16)27-23(28)24(2,3)4/h7-13H,1-6H3/t13-/m1/s1 |
| InChIKey | YNJKLAQFWQTMMH-CYBMUJFWSA-N |
| XLogP | 4.20 |
| TPSA | 135.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|