C32H33Br2N3O4 — CID 126309978
3-[(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126309978) has the molecular formula C32H33Br2N3O4 and a molecular weight of 683.44 g/mol. Its IUPAC name is 3-[(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126309978 |
| Molecular Formula | C32H33Br2N3O4 |
| Molecular Weight | 683.44 g/mol |
| Exact Mass | 681.08 |
| IUPAC Name | 3-[(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | C=CCOc1c(OCC)cc(C=Nn2c(-c3cc(C(C)C)c(OCC)cc3C)nc3ccccc3c2=O)c(Br)c1Br |
| InChI | InChI=1S/C32H33Br2N3O4/c1-7-14-41-30-27(40-9-3)16-21(28(33)29(30)34)18-35-37-31(36-25-13-11-10-12-22(25)32(37)38)24-17-23(19(4)5)26(39-8-2)15-20(24)6/h7,10-13,15-19H,1,8-9,14H2,2-6H3 |
| InChIKey | IDKDJPVWLMMKJO-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.44 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|