About 2-(diethylamino)ethyl N,N-diphenylcarbamate
2-(diethylamino)ethyl N,N-diphenylcarbamate (PubChem CID 12631) has the molecular formula C19H24N2O2
and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-(diethylamino)ethyl N,N-diphenylcarbamate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl N,N-diphenylcarbamate |
| PubChem CID | 12631 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 2-(diethylamino)ethyl N,N-diphenylcarbamate |
| SMILES | CCN(CC)CCOC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24N2O2/c1-3-20(4-2)15-16-23-19(22)21(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14H,3-4,15-16H2,1-2H3 |
| InChIKey | YDUHWSSRUBOPKZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(diethylamino)ethyl N,N-diphenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl N,N-diphenylcarbamate?
The IUPAC name of 2-(diethylamino)ethyl N,N-diphenylcarbamate (CID 12631) is 2-(diethylamino)ethyl N,N-diphenylcarbamate.
What is the SMILES notation for 2-(diethylamino)ethyl N,N-diphenylcarbamate?
The canonical SMILES for 2-(diethylamino)ethyl N,N-diphenylcarbamate is CCN(CC)CCOC(=O)N(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(diethylamino)ethyl N,N-diphenylcarbamate?
The InChIKey is YDUHWSSRUBOPKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O2/c1-3-20(4-2)15-16-23-19(22)21(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14H,3-4,15-16H2,1-2H3.
What are the key properties of 2-(diethylamino)ethyl N,N-diphenylcarbamate?
2-(diethylamino)ethyl N,N-diphenylcarbamate has a molecular weight of 312.41 g/mol, XLogP of 4.30, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl N,N-diphenylcarbamate is sourced from PubChem (CID 12631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).