C31H27IN4O7 — CID 126312748
3-[[3-iodo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126312748) has the molecular formula C31H27IN4O7 and a molecular weight of 694.48 g/mol. Its IUPAC name is 3-[[3-iodo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[[3-iodo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126312748 |
| Molecular Formula | C31H27IN4O7 |
| Molecular Weight | 694.48 g/mol |
| Exact Mass | 694.09 |
| IUPAC Name | 3-[[3-iodo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(-c3cc4c(OC)cccc4o3)nc3ccccc3c2=O)cc(I)c1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C31H27IN4O7/c1-39-24-8-5-9-25-21(24)16-27(43-25)30-34-23-7-4-3-6-20(23)31(38)36(30)33-17-19-14-22(32)29(26(15-19)40-2)42-18-28(37)35-10-12-41-13-11-35/h3-9,14-17H,10-13,18H2,1-2H3 |
| InChIKey | QEOHHFWXXXGCKX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 117.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|