C32H22Br2N4O7 — CID 126313826
3-[[2,3-dibromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126313826) has the molecular formula C32H22Br2N4O7 and a molecular weight of 734.36 g/mol. Its IUPAC name is 3-[[2,3-dibromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[[2,3-dibromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126313826 |
| Molecular Formula | C32H22Br2N4O7 |
| Molecular Weight | 734.36 g/mol |
| Exact Mass | 731.99 |
| IUPAC Name | 3-[[2,3-dibromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(-c3cc4c(OC)cccc4o3)nc3ccccc3c2=O)c(Br)c(Br)c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C32H22Br2N4O7/c1-42-24-11-6-12-25-22(24)15-27(45-25)31-36-23-10-4-3-9-21(23)32(39)37(31)35-16-19-14-26(43-2)30(29(34)28(19)33)44-17-18-7-5-8-20(13-18)38(40)41/h3-16H,17H2,1-2H3 |
| InChIKey | UFOFQRVLVNTOHE-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 131.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.36 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|