C28H24Br2N4O4 — CID 126314528
3-[[5-bromo-2-[(4-bromophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-cyclohexylquinazolin-4-one (PubChem CID 126314528) has the molecular formula C28H24Br2N4O4 and a molecular weight of 640.33 g/mol. Its IUPAC name is 3-[[5-bromo-2-[(4-bromophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-cyclohexylquinazolin-4-one.
| Compound Name | 3-[[5-bromo-2-[(4-bromophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
|---|---|
| PubChem CID | 126314528 |
| Molecular Formula | C28H24Br2N4O4 |
| Molecular Weight | 640.33 g/mol |
| Exact Mass | 638.02 |
| IUPAC Name | 3-[[5-bromo-2-[(4-bromophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(C2CCCCC2)n1N=Cc1cc(Br)cc([N+](=O)[O-])c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C28H24Br2N4O4/c29-21-12-10-18(11-13-21)17-38-26-20(14-22(30)15-25(26)34(36)37)16-31-33-27(19-6-2-1-3-7-19)32-24-9-5-4-8-23(24)28(33)35/h4-5,8-16,19H,1-3,6-7,17H2 |
| InChIKey | XIAVJYQWOWBWEX-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.33 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|