C31H27BrN4O5 — CID 126316502
6-bromo-2-butyl-3-[[3-methoxy-4-(naphthalen-1-ylmethoxy)-5-nitrophenyl]methylideneamino]quinazolin-4-one (PubChem CID 126316502) has the molecular formula C31H27BrN4O5 and a molecular weight of 615.48 g/mol. Its IUPAC name is 6-bromo-2-butyl-3-[[3-methoxy-4-(naphthalen-1-ylmethoxy)-5-nitrophenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-butyl-3-[[3-methoxy-4-(naphthalen-1-ylmethoxy)-5-nitrophenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126316502 |
| Molecular Formula | C31H27BrN4O5 |
| Molecular Weight | 615.48 g/mol |
| Exact Mass | 614.12 |
| IUPAC Name | 6-bromo-2-butyl-3-[[3-methoxy-4-(naphthalen-1-ylmethoxy)-5-nitrophenyl]methylideneamino]quinazolin-4-one |
| SMILES | CCCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(OC)c(OCc2cccc3ccccc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H27BrN4O5/c1-3-4-12-29-34-26-14-13-23(32)17-25(26)31(37)35(29)33-18-20-15-27(36(38)39)30(28(16-20)40-2)41-19-22-10-7-9-21-8-5-6-11-24(21)22/h5-11,13-18H,3-4,12,19H2,1-2H3 |
| InChIKey | ANEPNEOXAFNBAD-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 108.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.48 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|