C30H24BrCl2N3O2 — CID 126316681
6-bromo-2-[(2S)-butan-2-yl]-3-[[2-[(3,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]quinazolin-4-one (PubChem CID 126316681) has the molecular formula C30H24BrCl2N3O2 and a molecular weight of 609.35 g/mol. Its IUPAC name is 6-bromo-2-[(2S)-butan-2-yl]-3-[[2-[(3,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[[2-[(3,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126316681 |
| Molecular Formula | C30H24BrCl2N3O2 |
| Molecular Weight | 609.35 g/mol |
| Exact Mass | 607.04 |
| IUPAC Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[[2-[(3,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1c(OCc2ccc(Cl)c(Cl)c2)ccc2ccccc12 |
| InChI | InChI=1S/C30H24BrCl2N3O2/c1-3-18(2)29-35-27-12-10-21(31)15-23(27)30(37)36(29)34-16-24-22-7-5-4-6-20(22)9-13-28(24)38-17-19-8-11-25(32)26(33)14-19/h4-16,18H,3,17H2,1-2H3/t18-/m0/s1 |
| InChIKey | VNHLNHQEAPMAHY-SFHVURJKSA-N |
| XLogP | 8.59 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.35 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|