About (2R,3S)-2,3-di(propan-2-yl)aziridine
(2R,3S)-2,3-di(propan-2-yl)aziridine (PubChem CID 12632530) has the molecular formula C8H17N
and a molecular weight of 127.23 g/mol. Its IUPAC name is (2R,3S)-2,3-di(propan-2-yl)aziridine.
Molecular Properties
| Compound Name | (2R,3S)-2,3-di(propan-2-yl)aziridine |
| PubChem CID | 12632530 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | (2R,3S)-2,3-di(propan-2-yl)aziridine |
| SMILES | CC(C)[C@H]1N[C@H]1C(C)C |
| InChI | InChI=1S/C8H17N/c1-5(2)7-8(9-7)6(3)4/h5-9H,1-4H3/t7-,8+ |
| InChIKey | SGIOKISJHGLFFY-OCAPTIKFSA-N |
| XLogP | 1.64 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-2,3-di(propan-2-yl)aziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-2,3-di(propan-2-yl)aziridine?
The IUPAC name of (2R,3S)-2,3-di(propan-2-yl)aziridine (CID 12632530) is (2R,3S)-2,3-di(propan-2-yl)aziridine.
What is the SMILES notation for (2R,3S)-2,3-di(propan-2-yl)aziridine?
The canonical SMILES for (2R,3S)-2,3-di(propan-2-yl)aziridine is CC(C)[C@H]1N[C@H]1C(C)C.
What is the InChIKey of (2R,3S)-2,3-di(propan-2-yl)aziridine?
The InChIKey is SGIOKISJHGLFFY-OCAPTIKFSA-N. The full InChI is InChI=1S/C8H17N/c1-5(2)7-8(9-7)6(3)4/h5-9H,1-4H3/t7-,8+.
What are the key properties of (2R,3S)-2,3-di(propan-2-yl)aziridine?
(2R,3S)-2,3-di(propan-2-yl)aziridine has a molecular weight of 127.23 g/mol, XLogP of 1.64, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2,3-di(propan-2-yl)aziridine is sourced from PubChem (CID 12632530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).