C15H12N4S — CID 1263257
1-benzylsulfanyl-3H-[1,2,4]triazolo[4,3-a]benzimidazole (PubChem CID 1263257) has the molecular formula C15H12N4S and a molecular weight of 280.36 g/mol. Its IUPAC name is 1-benzylsulfanyl-3H-[1,2,4]triazolo[4,3-a]benzimidazole.
| Compound Name | 1-benzylsulfanyl-3H-[1,2,4]triazolo[4,3-a]benzimidazole |
|---|---|
| PubChem CID | 1263257 |
| Molecular Formula | C15H12N4S |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1-benzylsulfanyl-3H-[1,2,4]triazolo[4,3-a]benzimidazole |
| SMILES | c1ccc(CSc2n[nH]c3nc4ccccc4n23)cc1 |
| InChI | InChI=1S/C15H12N4S/c1-2-6-11(7-3-1)10-20-15-18-17-14-16-12-8-4-5-9-13(12)19(14)15/h1-9H,10H2,(H,16,17) |
| InChIKey | NHOMVVJPWGFSHQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |