C29H28BrFN4O4 — CID 126326135
2-[4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxyphenoxy]-N-(2-fluorophenyl)acetamide (PubChem CID 126326135) has the molecular formula C29H28BrFN4O4 and a molecular weight of 595.47 g/mol. Its IUPAC name is 2-[4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxyphenoxy]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxyphenoxy]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126326135 |
| Molecular Formula | C29H28BrFN4O4 |
| Molecular Weight | 595.47 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | 2-[4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxyphenoxy]-N-(2-fluorophenyl)acetamide |
| SMILES | CCOc1cc(C=Nn2c([C@@H](C)CC)nc3ccc(Br)cc3c2=O)ccc1OCC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C29H28BrFN4O4/c1-4-18(3)28-34-23-12-11-20(30)15-21(23)29(37)35(28)32-16-19-10-13-25(26(14-19)38-5-2)39-17-27(36)33-24-9-7-6-8-22(24)31/h6-16,18H,4-5,17H2,1-3H3,(H,33,36)/t18-/m0/s1 |
| InChIKey | OHUFRTDBNTZBFS-SFHVURJKSA-N |
| XLogP | 6.11 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.47 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|