About (Z)-1,3-dichlorobut-1-ene
(Z)-1,3-dichlorobut-1-ene (PubChem CID 12632712) has the molecular formula C4H6Cl2
and a molecular weight of 125.00 g/mol. Its IUPAC name is (Z)-1,3-dichlorobut-1-ene.
Molecular Properties
| Compound Name | (Z)-1,3-dichlorobut-1-ene |
| PubChem CID | 12632712 |
| Molecular Formula | C4H6Cl2 |
| Molecular Weight | 125.00 g/mol |
| Exact Mass | 123.98 |
| IUPAC Name | (Z)-1,3-dichlorobut-1-ene |
| SMILES | CC(Cl)/C=C\Cl |
| InChI | InChI=1S/C4H6Cl2/c1-4(6)2-3-5/h2-4H,1H3/b3-2- |
| InChIKey | GVNNGJMKAFLSHZ-IHWYPQMZSA-N |
| XLogP | 2.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.00 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,3-dichlorobut-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,3-dichlorobut-1-ene?
The IUPAC name of (Z)-1,3-dichlorobut-1-ene (CID 12632712) is (Z)-1,3-dichlorobut-1-ene.
What is the SMILES notation for (Z)-1,3-dichlorobut-1-ene?
The canonical SMILES for (Z)-1,3-dichlorobut-1-ene is CC(Cl)/C=C\Cl.
What is the InChIKey of (Z)-1,3-dichlorobut-1-ene?
The InChIKey is GVNNGJMKAFLSHZ-IHWYPQMZSA-N. The full InChI is InChI=1S/C4H6Cl2/c1-4(6)2-3-5/h2-4H,1H3/b3-2-.
What are the key properties of (Z)-1,3-dichlorobut-1-ene?
(Z)-1,3-dichlorobut-1-ene has a molecular weight of 125.00 g/mol, XLogP of 2.37, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,3-dichlorobut-1-ene is sourced from PubChem (CID 12632712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).