C26H21BrCl2IN3O2 — CID 126327882
6-bromo-2-butyl-3-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodophenyl]methylideneamino]quinazolin-4-one (PubChem CID 126327882) has the molecular formula C26H21BrCl2IN3O2 and a molecular weight of 685.19 g/mol. Its IUPAC name is 6-bromo-2-butyl-3-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodophenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-butyl-3-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodophenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126327882 |
| Molecular Formula | C26H21BrCl2IN3O2 |
| Molecular Weight | 685.19 g/mol |
| Exact Mass | 682.92 |
| IUPAC Name | 6-bromo-2-butyl-3-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodophenyl]methylideneamino]quinazolin-4-one |
| SMILES | CCCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(OCc2ccc(Cl)c(Cl)c2)c(I)c1 |
| InChI | InChI=1S/C26H21BrCl2IN3O2/c1-2-3-4-25-32-23-9-7-18(27)13-19(23)26(34)33(25)31-14-16-6-10-24(22(30)12-16)35-15-17-5-8-20(28)21(29)11-17/h5-14H,2-4,15H2,1H3 |
| InChIKey | HFXCPVCPZQXVSM-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.19 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|