C27H27BrClN5O6 — CID 126329487
6-bromo-3-[[5-chloro-2-(2-morpholin-4-yl-2-oxoethoxy)-3-nitrophenyl]methylideneamino]-2-cyclohexylquinazolin-4-one (PubChem CID 126329487) has the molecular formula C27H27BrClN5O6 and a molecular weight of 632.90 g/mol. Its IUPAC name is 6-bromo-3-[[5-chloro-2-(2-morpholin-4-yl-2-oxoethoxy)-3-nitrophenyl]methylideneamino]-2-cyclohexylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[5-chloro-2-(2-morpholin-4-yl-2-oxoethoxy)-3-nitrophenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
|---|---|
| PubChem CID | 126329487 |
| Molecular Formula | C27H27BrClN5O6 |
| Molecular Weight | 632.90 g/mol |
| Exact Mass | 631.08 |
| IUPAC Name | 6-bromo-3-[[5-chloro-2-(2-morpholin-4-yl-2-oxoethoxy)-3-nitrophenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
| SMILES | O=C(COc1c(C=Nn2c(C3CCCCC3)nc3ccc(Br)cc3c2=O)cc(Cl)cc1[N+](=O)[O-])N1CCOCC1 |
| InChI | InChI=1S/C27H27BrClN5O6/c28-19-6-7-22-21(13-19)27(36)33(26(31-22)17-4-2-1-3-5-17)30-15-18-12-20(29)14-23(34(37)38)25(18)40-16-24(35)32-8-10-39-11-9-32/h6-7,12-15,17H,1-5,8-11,16H2 |
| InChIKey | NJEANTLEWYMISC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 129.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.90 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|