C21H30N2 — CID 1263295
1,3,3,6,10-pentamethyl-8-(2,2,5-trimethyl-3H-pyrrol-4-ylidene)-2-azaspiro[4.5]deca-1,6,9-triene (PubChem CID 1263295) has the molecular formula C21H30N2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 1,3,3,6,10-pentamethyl-8-(2,2,5-trimethyl-3H-pyrrol-4-ylidene)-2-azaspiro[4.5]deca-1,6,9-triene.
| Compound Name | 1,3,3,6,10-pentamethyl-8-(2,2,5-trimethyl-3H-pyrrol-4-ylidene)-2-azaspiro[4.5]deca-1,6,9-triene |
|---|---|
| PubChem CID | 1263295 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 1,3,3,6,10-pentamethyl-8-(2,2,5-trimethyl-3H-pyrrol-4-ylidene)-2-azaspiro[4.5]deca-1,6,9-triene |
| SMILES | CC1=CC(=C2CC(C)(C)N=C2C)C=C(C)C12CC(C)(C)N=C2C |
| InChI | InChI=1S/C21H30N2/c1-13-9-17(18-11-19(5,6)22-15(18)3)10-14(2)21(13)12-20(7,8)23-16(21)4/h9-10H,11-12H2,1-8H3/b18-17- |
| InChIKey | PKQMXMVSTGCYLQ-ZCXUNETKSA-N |
| XLogP | 5.46 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |