C24H22Cl2N2O5S — CID 126330390
methyl (3S,4S)-4-(3-chloro-4-ethoxyphenyl)-6-[2-(2-chlorophenoxy)ethylsulfanyl]-5-cyano-2-oxo-3,4-dihydro-1H-pyridine-3-carboxylate (PubChem CID 126330390) has the molecular formula C24H22Cl2N2O5S and a molecular weight of 521.42 g/mol. Its IUPAC name is methyl (3S,4S)-4-(3-chloro-4-ethoxyphenyl)-6-[2-(2-chlorophenoxy)ethylsulfanyl]-5-cyano-2-oxo-3,4-dihydro-1H-pyridine-3-carboxylate.
| Compound Name | methyl (3S,4S)-4-(3-chloro-4-ethoxyphenyl)-6-[2-(2-chlorophenoxy)ethylsulfanyl]-5-cyano-2-oxo-3,4-dihydro-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 126330390 |
| Molecular Formula | C24H22Cl2N2O5S |
| Molecular Weight | 521.42 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | methyl (3S,4S)-4-(3-chloro-4-ethoxyphenyl)-6-[2-(2-chlorophenoxy)ethylsulfanyl]-5-cyano-2-oxo-3,4-dihydro-1H-pyridine-3-carboxylate |
| SMILES | CCOc1ccc([C@H]2C(C#N)=C(SCCOc3ccccc3Cl)NC(=O)[C@H]2C(=O)OC)cc1Cl |
| InChI | InChI=1S/C24H22Cl2N2O5S/c1-3-32-19-9-8-14(12-17(19)26)20-15(13-27)23(28-22(29)21(20)24(30)31-2)34-11-10-33-18-7-5-4-6-16(18)25/h4-9,12,20-21H,3,10-11H2,1-2H3,(H,28,29)/t20-,21-/m0/s1 |
| InChIKey | SSCBFXOARJLUAZ-SFTDATJTSA-N |
| XLogP | 4.94 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|