C20H17BrN2O2S — CID 126331325
(4S)-4-(3-bromophenyl)-2-oxo-6-(2-phenoxyethylsulfanyl)-3,4-dihydro-1H-pyridine-5-carbonitrile (PubChem CID 126331325) has the molecular formula C20H17BrN2O2S and a molecular weight of 429.34 g/mol. Its IUPAC name is (4S)-4-(3-bromophenyl)-2-oxo-6-(2-phenoxyethylsulfanyl)-3,4-dihydro-1H-pyridine-5-carbonitrile.
| Compound Name | (4S)-4-(3-bromophenyl)-2-oxo-6-(2-phenoxyethylsulfanyl)-3,4-dihydro-1H-pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 126331325 |
| Molecular Formula | C20H17BrN2O2S |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | (4S)-4-(3-bromophenyl)-2-oxo-6-(2-phenoxyethylsulfanyl)-3,4-dihydro-1H-pyridine-5-carbonitrile |
| SMILES | N#CC1=C(SCCOc2ccccc2)NC(=O)C[C@H]1c1cccc(Br)c1 |
| InChI | InChI=1S/C20H17BrN2O2S/c21-15-6-4-5-14(11-15)17-12-19(24)23-20(18(17)13-22)26-10-9-25-16-7-2-1-3-8-16/h1-8,11,17H,9-10,12H2,(H,23,24)/t17-/m0/s1 |
| InChIKey | XETNULNNVOFWBX-KRWDZBQOSA-N |
| XLogP | 4.60 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|